2C-G
|
|
|
|
| Names
|
Preferred IUPAC name
2-(2,5-Dimethoxy-3,4-dimethylphenyl)ethan-1-amine
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C12H19NO2/c1-8-9(2)12(15-4)10(5-6-13)7-11(8)14-3/h7H,5-6,13H2,1-4H3 Y Key: NFOHGLKGLZIHJQ-UHFFFAOYSA-N Y InChI=1/C12H19NO2/c1-8-9(2)12(15-4)10(5-6-13)7-11(8)14-3/h7H,5-6,13H2,1-4H3 Key: NFOHGLKGLZIHJQ-UHFFFAOYAX
|
|
|
| Properties
|
|
|
C12H19NO2
|
| Molar mass
|
209.289 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
2C-G is a psychedelic phenethylamine of the 2C-series. First synthesized by Alexander Shulgin,[1] it is sometimes used as an entheogen. It has structural and pharmacodynamic properties similar to 2C-D and Ganesha. Like many of the phenethylamines in PiHKAL, 2C-G and its homologs have only been taken by Shulgin and a small test group, making it difficult to ensure completeness when describing effects.
Chemistry
2C-G is 3,4-dimethyl-2,5-dimethoxyphenethylamine, with the formula C
12H
19NO
2.
Dosage and effects
In Shulgin's book PiHKAL, the dosage range is listed as 20 to 35 mg.[1] Effects are similar to the related Ganesha, and are extremely long lasting; the duration is 18–30 hours. Visual effects are muted or absent, and it is described in PiHKAL as an "insight-enhancer".[1] Unlike other members of the 2C-series, 2C-G is nearly as potent as its amphetamine form.
Homologs
Several homologs of 2C-G were also synthesized by Shulgin. These include 2C-G-3, 2C-G-5, and 2C-G-N. Some, such as 2C-G-1, 2C-G-2, 2C-G-4, and 2C-G-6 are possible to synthesize in principle but impossible or extraordinarily difficult to do so in practice.
| 2C-G-1
|
CAS: 2888537-47-9
The synthesis of this compound has not been reported, but it is described prophetically in WO2022271982
|
|
| 2C-G-2
|
CAS: 2888537-48-0
The synthesis of this compound has not been reported, but it is described prophetically in WO2022271982
|
|
| 2C-G-3
|
CAS: 207740-19-0
Dosage: 16–25 mg
Duration: 12–24 hours
Effects: Some visual effects. General euphoria with an underlying sense of paranoia.
|
|
| 2C-G-4
|
CAS: 952006-59-6
Synthesized but not tested.
|
|
| 2C-G-5
|
CAS: 207740-20-3
Dosage: 10–16 mg
Duration: 32–48 hours
Effects: Similar to 2C-B for some users. General euphoria (sometimes followed by irritability), often leading to tiredness (likely due to duration).
|
|
| 2C-G-6
|
CAS: 2888537-49-1
The synthesis of this compound has not been reported, but it is described prophetically in WO2022271982
|
|
| 2C-G-N
|
CAS: 207740-21-4
Dosage: 20–40 mg
Duration: 20–30 hours
Effects: Stimulation similar to that caused by amphetamines. General sense of unease or unfriendliness for most. 2C-G-N is sometimes called 2C-NPH due to the Naphthalene portion of the molecule.
|
|
Legal status
Canada
As of October 31, 2016; 2C-G is a controlled substance (Schedule III) in Canada.[2]
United Kingdom
2C-G and all other compounds featuring in PiHKAL are Class A drugs in the United Kingdom.
United States
In the United States 2C-G is considered a Schedule 1 controlled substance as a positional isomer of 2C-E and 2,5-Dimethoxy-4-methylamphetamine (DOM).[3]
See also
References
External links
|
|---|
| | No ring subs. | |
|---|
| 4-Hydroxytryptamines | |
|---|
| 5-Hydroxytryptamines | |
|---|
| 5-Methoxytryptamines | |
|---|
| Other ring subs. |
- 2,N,N-TMT
- 4,N,N-TMT
- 5-Bromo-DMT
- 5-Chloro-DMT
- 5-Fluoro-DMT
- 5-N,N-TMT
- 7,N,N-TMT
- 5-MeO-2,N,N-TMT
- 5-MeO-4,N,N-TMT
- 6-Fluoro-DMT
- Bretisilocin (GM-2505; 5-fluoro-MET)
|
|---|
| α-Alkyltryptamines |
- 5-Methoxy-α-alkyltryptamines: 5-MeO-AET
- α,N,N-TMT (α-Me-DMT; Alpha-N)
- 5-MeO-AMT (α,O-DMS; Alpha-O)
- α,N,O-TMS (5-MeO-α,N-DMT)
- α,N,N,O-TeMS (5-MeO-α,N,N-TMT)
|
|---|
| Others | |
|---|
|
- Ergolines/lysergamides (e.g., LSD)
- β-Carbolines and Harmala alkaloids (e.g., harmine, harmaline, 6-methoxyharmalan)
- Iboga alkaloids (e.g., 18-MAC, 18-MC, coronaridine, ibogaine, ibogamine, ME-18-MC, noribogaine, tabernanthine, voacangine)
- Ibogalogs (e.g., ibogainalog)
- O-Methylnordehydrobufotenine
- Partial ergolines (e.g., NDTDI, RU-28306, CT-5252)
- Piperidinylethylindoles (e.g., Pip-T)
- Pyrrolidinylethylindoles (e.g., Pyr-T, 5-MeO-pyr-T)
- Pyrrolidinylmethylindoles (e.g., MPMI, 4-HO-MPMI (lucigenol), 5-MeO-MPMI)
|
|---|
|
- Benzofurans (e.g., 5-MeO-DiBF, dimemebfe (5-MeO-BFE), mebfap)
- Benzothiophenes (e.g., 3-APBT)
- Indazoles (e.g., AL-38022A, O-methyl-AL-34662)
- Indenes (e.g., C-DMT)
- Isotryptamines (e.g., 6-MeO-isoDMT, Ro60-0175)
- MYCO-005
- Quinolinylethylamines (e.g., mefloquine)
|
|---|
|
|---|
| | |
|---|
|
- Others: 2C-G-x (e.g., 2C-G-3, 2C-G-5)
- β-Keto-2C-B (βk-2C-B)
- β-Keto-2C-I (βk-2C-I)
- β-Methyl-2C-B (BMB)
- (e.g., BOB, BOD, BOH-2C-B)
- (e.g., HOT-2, HOT-7, HOT-17)
- N-Ethyl-2C-B
- (e.g., 2CD-2-ETO, 2CD-5-ETO, 2CE-5-ETO, 2CE-5iPrO, 2CT2-5-ETO, ASR-2001 (2CB-5PrO))
|
|---|
| |
|---|
|
- TMA-2 and derivatives (Mxx): MALM
- MEM
- MDFEM
- MFEM
- MIPM
- MMALM
- MPM
- MTFEM
- TMA-2
|
|---|
| |
|---|
| |
|---|
| |
|---|
| |
|---|
| Others |
- 2-TOET
- 2-TOM
- 25B-NAcPip
- 4-HA
- 5-TOET
- 5-TOM
- Benzofurans (e.g., 5-APB, 5-APDB, 6-APB, 6-APDB, F-2, F-22)
- Benzothiophenes (e.g., 5-APBT, 6-APBT)
- CT-5172
- DMAs (e.g., 2,4-DMA, 3,4-DMA)
- Fenfluramine
- MMA (3-MeO-4-MA)
- Norfenfluramine
- (e.g., 25D-NM-NDEAOP, DOB-NDEPA, DOI-NDEPA, DOM-NDEPA, DOTFM-NDEPA, M-NDEPA, TMA-2-NDEPA)
- PMA (4-MA)
- (e.g., TMA-3, TMA-4, TMA-5, TMA-6)
- TOMSO
- ZDCM-04
|
|---|
|
- 1-Aminomethylindanes (e.g., 2CB-Ind, jimscaline)
- 2-Aminoindanes (e.g., DOM-AI)
- 3-Phenylpiperidines (e.g., LPH-5, LPH-48)
- Benzazepines (e.g., lorcaserin)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- DMBMPP (juncosamine)
- Ergolines/lysergamides (e.g., LSD)
- Glaucine
- IHCH-7113
- Partial ergolines (e.g., NDTDI, DEIMDHPCA, DEMPDHPCA, DEMTMPDHPCA, DEMNDHPCA)
- Phenylcyclopropylamines (e.g., DMCPA, TMT)
- Phenyloxazolamines (aminorexes) (e.g., 2C-B-aminorex)
- Z3517967757
- ZC-B
|
|---|
|
|---|
| |
|---|
| Others |
- Arylpiperazines (e.g., 2C-B-PP, 2-NP, mCPP, MK-212, ORG-12962, pCPP, pFPP, quipazine, TFMPP)
- Dihydrobenzoxazines (e.g., efavirenz)
- Phenoxyethylamines (e.g., CT-4719, ORG-37684)
- Quinazolinylethylamines (e.g., RH-34)
|
|---|
| Natural sources |
- Tryptamines: Acacia spp. (e.g., Acacia acuminata, Acacia confusa)
- Ayahuasca and vinho de Jurema (e.g., Psychotria viridis (chacruna), Dipolopterys cabrerana (chaliponga, chacruna), Mimosa tenuiflora (Mimosa hostilis; jurema))
- Brosimum (e.g., Brosimum acutifolium (takini))
- Hallucinogenic snuffs (e.g., Anadenanthera peregrina (yopo, jopo, cohoba, parica, ebene), Anadenanthera colubrina (vilca, cebil))
- Incilius alvarius (Bufo alvarius; Colorado River toad, Sonoran Desert toad; bufo)
- Psilocybin-containing mushrooms (magic mushrooms, shrooms) (e.g., Psilocybe cubensis, Psilocybe mexicana (teonanacatl))
- Lysergamides: Achnatherum robustum (sleepy grass)
- Epichloë spp.
- Ergot (Claviceps) (e.g., Claviceps purpurea, Claviceps paspali)
- Morning glory (Convolvulaceae) seeds (e.g., Ipomoea tricolor (tlitliltzin, badoh negro; Ipomoea violacea), Ipomoea corymbosa (coaxihuitl, ololiúqui; Rivea Corymbosa, Turbina Corymbosa), Argyreia nervosa (Hawaiian baby woodrose; HBWR))
- Periglandula spp. (e.g., Periglandula ipomoeae, Periglandula clandestina)
|
|---|
- See also: Hallucinogens
- Entactogens
- Tryptamines
- Phenethylamines
- Ergolines and lysergamides
- Serotonin receptor modulators
|
|
|---|
| Phenethylamines | |
|---|
| Amphetamines | |
|---|
| Phentermines | |
|---|
| Cathinones | |
|---|
Phenylisobutylamines (and further-extended) | |
|---|
Catecholamines (and close relatives) | |
|---|
Cyclized phenethylamines | | Phenylalkylpyrrolidines | |
|---|
2-Benzylpiperidines (phenidates) | |
|---|
Phenylmorpholines (phenmetrazines) | |
|---|
Phenyloxazolamines (aminorexes) | |
|---|
Isoquinolines and tetrahydroisoquinolines | |
|---|
| 2-Aminoindanes | |
|---|
| 2-Aminotetralins | |
|---|
| Others / unsorted |
- 1-Aminomethylindanes (e.g., 2CB-Ind, AMMI, bromojimscaline, jimscaline)
- 2-ADN
- 2-Benzhydrylpyrrolidine
- 2C-B-5-hemiFLY-α6 (BNAP)
- 3-Benzhydrylmorpholine
- 3-Phenylpiperidines (e.g., 3-phenylpiperidine, OSU-6162 (PNU-96391), LPH-5, LPH-48)
- 6-AB
- AL-1095
- Aminochromes (e.g., adrenochrome, adrenolutin)
- Benzazepines (e.g., fenoldopam, lorcaserin, SCHEMBL5334361)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, bromotomscaline, S33005, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- Butyltolylquinuclidine
- Cypenamine (trans-2-phenylcyclopentylamine)
- Diphenidine
- Diphenylprolinol
- DMBMPP
- Ergolines (e.g., LSD)
- GYKI-52895
- HDMP-29
- Ivabradine
- Lumateperone and analogues (e.g., IHCH-7079, IHCH-7086, IHCH-7113, ITI-1549)
- Methoxphenidine
- Methylmorphenate
- Milnacipran
- MT-45
- 2-Naphthylamine
- Org 6582
- Partial ergolines (e.g., NDTDI, RU-27849, DEIMDHPCA, DEMPDHPCA, DEMPDHPCA-2C-D, RU-27251)
- PF-592,379
- Phenylcyclopropylamines (e.g., DMCPA, TMT, tranylcypromine)
- Tetrahydrobenzopyranylamines (e.g., CT-5126)
- Tricyclics (e.g., benzoctamine, dizocilpine)
- Z3517967757
- ZC-B
|
|---|
|
|---|
| Related compounds |
- 2-Furylethylamine
- 2-Pyrrolylethylamine
- 3-Pyrrolylethylamine
- 3-Pyrrolylpropylamine
- 2-Tetrahydrofurylethylamine
- 4-Benzylpiperidine
- 7-AB
- Alkylamines (e.g., 1,3-DMBATooltip 1,3-dimethylbutylamine, 1,4-DMAATooltip 1,4-dimethylamylamine, heptaminol, iproheptine, isometheptene, methylhexanamine/1,3-DMAA, octodrine, oenethyl, tuaminoheptane)
- Benzylamines (e.g., benzylamine, α-methylbenzylamine, MDM1EA, ALPHA, M-ALPHA, pargyline)
- Benzylpiperazines (e.g., benzylpiperazine, MDBZP, fipexide)
- Cyclohexylaminopropanes (e.g., propylhexedrine, norpropylhexedrine)
- Cyclopentylaminopropanes (e.g., isocyclamine, cyclopentamine)
- Phenoxyethylamines (e.g., 3,4,5-trimethoxyphenoxyethylamine, CT-4719, ORG-37684)
- Phenylalkenylamines (e.g., phenylbutenamine)
- Phenylalkynylamines (e.g., phenylbutynamine)
- Phenylpiperazines (e.g., 1-phenylpiperazine, mCPPTooltip meta-chlorophenylpiperazine, TFMPPTooltip trifluoromethylphenylpiperazine, oMPPTooltip ortho-methylphenylpiperazine, pFPPTooltip para-fluorophenylpiperazine, pMeOPPTooltip para-methoxyphenylpiperazine)
- Phenylpropylamines (e.g., phenylpropylamine, homo-MDA, homo-MDMA)
- Thienylaminopropanes (thiopropamines) (e.g., thiopropamine, methiopropamine, thiothinone)
|
|---|
- See also: Tryptamines
- Ergolines and lysergamides
- Stimulants
- Entactogens
- Psychedelics
|