Allocryptopine
|
|
| Names
|
Preferred IUPAC name
3,4-Dimethoxy-6-methyl-5,7,8,15-tetrahydro-11H-[1,3]benzodioxolo[5,6-e][2]benzazecin-14(6H)-one
|
| Other names
Thalictrimine; allo-Cryptopine; α-Fagarine; Fagarine I; α-Allocryptopine; β-Homochelidonine
|
| Identifiers
|
|
|
|
|
|
|
| ChEBI
|
|
| ChemSpider
|
|
| ECHA InfoCard
|
100.006.933
|
| EC Number
|
|
| KEGG
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C21H23NO5/c1-22-7-6-14-9-19-20(27-12-26-19)10-15(14)17(23)8-13-4-5-18(24-2)21(25-3)16(13)11-22/h4-5,9-10H,6-8,11-12H2,1-3H3 Key: HYBRYAPKQCZIAE-UHFFFAOYSA-N
|
CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C(=C(C=C4)OC)OC)OCO3
|
| Properties
|
|
|
C21H23NO5
|
| Molar mass
|
369.417 g·mol−1
|
| Hazards
|
| Occupational safety and health (OHS/OSH):
|
Main hazards
|
H302 (100%): Harmful if swallowed, acute toxicity[1]
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Allocryptopine is a bioactive alkaloid found in plants of the Papaveraceae family, including Glaucium arabicum,[2] Argemone mexicana, Eschscholtzia, Corydalis, Fumaria, Chelidonium, Hunnemannia fumariifolia, Eschscholzia lobbii[3] and other Papaveraceae plants.[4][5]
See also
References
|
|---|
| Phenethylamines | |
|---|
| Amphetamines | |
|---|
| Phentermines | |
|---|
| Cathinones | |
|---|
Phenylisobutylamines (and further-extended) | |
|---|
Catecholamines (and close relatives) | |
|---|
Cyclized phenethylamines | | Phenylalkylpyrrolidines | |
|---|
2-Benzylpiperidines (phenidates) | |
|---|
Phenylmorpholines (phenmetrazines) | |
|---|
Phenyloxazolamines (aminorexes) | |
|---|
Isoquinolines and tetrahydroisoquinolines | |
|---|
| 2-Aminoindanes | |
|---|
| 2-Aminotetralins | |
|---|
| Others / unsorted |
- 1-Aminomethylindanes (e.g., 2CB-Ind, AMMI, bromojimscaline, jimscaline)
- 2-ADN
- 2-Benzhydrylpyrrolidine
- 2C-B-5-hemiFLY-α6 (BNAP)
- 3-Benzhydrylmorpholine
- 3-Phenylpiperidines (e.g., 3-phenylpiperidine, OSU-6162 (PNU-96391), LPH-5, LPH-48)
- 6-AB
- AL-1095
- Aminochromes (e.g., adrenochrome, adrenolutin)
- Benzazepines (e.g., fenoldopam, lorcaserin, SCHEMBL5334361)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, bromotomscaline, S33005, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- Butyltolylquinuclidine
- Cypenamine (trans-2-phenylcyclopentylamine)
- Diphenidine
- Diphenylprolinol
- DMBMPP
- Ergolines (e.g., LSD)
- GYKI-52895
- HDMP-29
- Ivabradine
- Lumateperone and analogues (e.g., IHCH-7079, IHCH-7086, IHCH-7113, ITI-1549)
- Methoxphenidine
- Methylmorphenate
- Milnacipran
- MT-45
- 2-Naphthylamine
- Org 6582
- Partial ergolines (e.g., NDTDI, RU-27849, DEIMDHPCA, DEMPDHPCA, DEMPDHPCA-2C-D, RU-27251)
- PF-592,379
- Phenylcyclopropylamines (e.g., DMCPA, TMT, tranylcypromine)
- Tetrahydrobenzopyranylamines (e.g., CT-5126)
- Tricyclics (e.g., benzoctamine, dizocilpine)
- Z3517967757
- ZC-B
|
|---|
|
|---|
| Related compounds |
- 2-Furylethylamine
- 2-Pyrrolylethylamine
- 3-Pyrrolylethylamine
- 3-Pyrrolylpropylamine
- 2-Tetrahydrofurylethylamine
- 4-Benzylpiperidine
- 7-AB
- Alkylamines (e.g., 1,3-DMBATooltip 1,3-dimethylbutylamine, 1,4-DMAATooltip 1,4-dimethylamylamine, heptaminol, iproheptine, isometheptene, methylhexanamine/1,3-DMAA, octodrine, oenethyl, tuaminoheptane)
- Benzylamines (e.g., benzylamine, α-methylbenzylamine, MDM1EA, ALPHA, M-ALPHA, pargyline)
- Benzylpiperazines (e.g., benzylpiperazine, MDBZP, fipexide)
- Cyclohexylaminopropanes (e.g., propylhexedrine, norpropylhexedrine)
- Cyclopentylaminopropanes (e.g., isocyclamine, cyclopentamine)
- Phenoxyethylamines (e.g., 3,4,5-trimethoxyphenoxyethylamine, CT-4719, ORG-37684)
- Phenylalkenylamines (e.g., phenylbutenamine)
- Phenylalkynylamines (e.g., phenylbutynamine)
- Phenylpiperazines (e.g., 1-phenylpiperazine, mCPPTooltip meta-chlorophenylpiperazine, TFMPPTooltip trifluoromethylphenylpiperazine, oMPPTooltip ortho-methylphenylpiperazine, pFPPTooltip para-fluorophenylpiperazine, pMeOPPTooltip para-methoxyphenylpiperazine)
- Phenylpropylamines (e.g., phenylpropylamine, homo-MDA, homo-MDMA)
- Thienylaminopropanes (thiopropamines) (e.g., thiopropamine, methiopropamine, thiothinone)
|
|---|
- See also: Tryptamines
- Ergolines and lysergamides
- Stimulants
- Entactogens
- Psychedelics
|