Cefbuperazone |
|
| AHFS/Drugs.com | International Drug Names |
|---|
Routes of administration | IM, IV |
|---|
| ATC code | |
|---|
|
| Legal status |
- In general: ℞ (Prescription only)
|
|---|
|
(6R,7S)-7-([(2R,3S)-2-[(4-Ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-3-hydroxybutanoyl]amino)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C22H29N9O9S2 |
|---|
| Molar mass | 627.65 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CCN1CCN(C(=O)C1=O)C(=O)N[C@H]([C@H](C)O)C(=O)N[C@]2([C@@H]3N(C2=O)C(=C(CS3)CSC4=NN=NN4C)C(=O)O)OC
|
InChI=1S/C22H29N9O9S2/c1-5-29-6-7-30(16(35)15(29)34)20(39)23-12(10(2)32)14(33)24-22(40-4)18(38)31-13(17(36)37)11(8-41-19(22)31)9-42-21-25-26-27-28(21)3/h10,12,19,32H,5-9H2,1-4H3,(H,23,39)(H,24,33)(H,36,37)/t10-,12+,19+,22-/m0/s1 NKey:SMSRCGPDNDCXFR-CYWZMYCQSA-N N
|
N Y (what is this?) (verify) |
Cefbuperazone (INN) is a second-generation cephalosporin antibiotic.[1][2]
References
- ^ Izumi K, Kawazoe K, Mikamo H, Ito K, Tamaya T (November 1995). "In vivo bacterial regrowth-inhibition effect of cefbuperazone and amikacin in puerperal uterine cavity". Journal of Chemotherapy. 7 (Suppl 4): 173–6. PMID 8904147.
- ^ US 4754030, "Cefbuperazone crystalline triethylamine salt"
|
|---|
β-lactams (inhibit synthesis of peptidoglycan layer of bacterial cell wall by binding to and inhibiting PBPs, a group of D-alanyl-D-alanine transpeptidases) | |
|---|
| Polypeptides | | Lipopeptides |
- Insert into bacterial cell wall causing perforation and depolarization: Daptomycin
- Surfactin
|
|---|
| Other |
- Inhibits PG elongation and crosslinking: Ramoplanin§
|
|---|
|
|---|
| Intracellular |
- Inhibit PG subunit synthesis and transport: NAM synthesis inhibition
- DADAL/AR inhibitors
- bactoprenol inhibitors
|
|---|
| Other | |
|---|
|