Cefuzonam |
|
| ATC code | |
|---|
|
| Legal status |
- In general: ℞ (Prescription only)
|
|---|
|
(6R,7R)-7-([(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino)-8-oxo-3-(thiadiazol-5-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| KEGG | |
|---|
| ChEMBL | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C16H15N7O5S4 |
|---|
| Molar mass | 513.58 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
CON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(=C(CS3)CSC4=CN=NS4)C(=O)O
|
InChI=1S/C16H15N7O5S4/c1-28-21-9(7-5-31-16(17)19-7)12(24)20-10-13(25)23-11(15(26)27)6(4-30-14(10)23)3-29-8-2-18-22-32-8/h2,5,10,14H,3-4H2,1H3,(H2,17,19)(H,20,24)(H,26,27)/b21-9-/t10-,14-/m1/s1 NKey:CXHKZHZLDMQGFF-ZSDSSEDPSA-N N
|
N Y (what is this?) (verify) |
Cefuzonam (INN) is a second-generation cephalosporin antibiotic.
References
- Hara K, Matsumoto F (December 1987). "[New antimicrobial agent series XXVIII: cefuzonam]". The Japanese Journal of Antibiotics (in Japanese). 40 (12): 1953–63. PMID 3329242.
|
|---|
β-lactams (inhibit synthesis of peptidoglycan layer of bacterial cell wall by binding to and inhibiting PBPs, a group of D-alanyl-D-alanine transpeptidases) | |
|---|
| Polypeptides | | Lipopeptides |
- Insert into bacterial cell wall causing perforation and depolarization: Daptomycin
- Surfactin
|
|---|
| Other |
- Inhibits PG elongation and crosslinking: Ramoplanin§
|
|---|
|
|---|
| Intracellular |
- Inhibit PG subunit synthesis and transport: NAM synthesis inhibition
- DADAL/AR inhibitors
- bactoprenol inhibitors
|
|---|
| Other | |
|---|
|