Epicillin |
|
| ATC code | |
|---|
|
(2S,5R,6R)-6-[[(2R)-2-Amino-2-(1-cyclohexa-1,4-dienyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
| ECHA InfoCard | 100.043.623 |
|---|
|
| Formula | C16H21N3O4S |
|---|
| Molar mass | 351.42 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)[C@@H](C/1=C/C\C=C/C\1)N)[C@H]3SC2(C)C
|
InChI=1S/C16H21N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-4,7,9-11,14H,5-6,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1 NKey:RPBAFSBGYDKNRG-NJBDSQKTSA-N N
|
N Y (what is this?) (verify) |
Epicillin (INN) is a penicillin antibiotic. It is not approved by the FDA for use in the United States.
It is an aminopenicillin.[1][2]
References
- ^ Bergan T (1979). "Studies on aminopenicillin developments. Proceedings of a symposium. Concluding remarks". Infection. 7 (Suppl 5): S507-512. doi:10.1007/bf01659785. PMID 389828. S2CID 46974138.
- ^ Mombelli G (May 1981). "[Aminopenicillin: when, how, what kind?]". Schweizerische Medizinische Wochenschrift (in German). 111 (18): 641–5. PMID 7244588.
|
|---|
β-lactams (inhibit synthesis of peptidoglycan layer of bacterial cell wall by binding to and inhibiting PBPs, a group of D-alanyl-D-alanine transpeptidases) | |
|---|
| Polypeptides | | Lipopeptides |
- Insert into bacterial cell wall causing perforation and depolarization: Daptomycin
- Surfactin
|
|---|
| Other |
- Inhibits PG elongation and crosslinking: Ramoplanin§
|
|---|
|
|---|
| Intracellular |
- Inhibit PG subunit synthesis and transport: NAM synthesis inhibition
- DADAL/AR inhibitors
- bactoprenol inhibitors
|
|---|
| Other | |
|---|
|